C14H19BrO3 — CID 18652115
(2R,3S)-4-[(4-bromophenyl)methoxy]-2-prop-2-enylbutane-1,3-diol (PubChem CID 18652115) has the molecular formula C14H19BrO3 and a molecular weight of 315.21 g/mol. Its IUPAC name is (2R,3S)-4-[(4-bromophenyl)methoxy]-2-prop-2-enylbutane-1,3-diol.
| Compound Name | (2R,3S)-4-[(4-bromophenyl)methoxy]-2-prop-2-enylbutane-1,3-diol |
|---|---|
| PubChem CID | 18652115 |
| Molecular Formula | C14H19BrO3 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | (2R,3S)-4-[(4-bromophenyl)methoxy]-2-prop-2-enylbutane-1,3-diol |
| SMILES | C=CC[C@H](CO)[C@H](O)COCc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H19BrO3/c1-2-3-12(8-16)14(17)10-18-9-11-4-6-13(15)7-5-11/h2,4-7,12,14,16-17H,1,3,8-10H2/t12-,14-/m1/s1 |
| InChIKey | FTTRACSKCTUNIB-TZMCWYRMSA-N |
| XLogP | 2.51 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|