C11H13BrO2 — CID 10083994
(E)-4-[(4-bromophenyl)methoxy]-2,3,4,4-tetradeuteriobut-2-en-1-ol (PubChem CID 10083994) has the molecular formula C11H13BrO2 and a molecular weight of 261.15 g/mol. Its IUPAC name is (E)-4-[(4-bromophenyl)methoxy]-2,3,4,4-tetradeuteriobut-2-en-1-ol.
| Compound Name | (E)-4-[(4-bromophenyl)methoxy]-2,3,4,4-tetradeuteriobut-2-en-1-ol |
|---|---|
| PubChem CID | 10083994 |
| Molecular Formula | C11H13BrO2 |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | (E)-4-[(4-bromophenyl)methoxy]-2,3,4,4-tetradeuteriobut-2-en-1-ol |
| SMILES | [2H]/C(CO)=C(/[2H])C([2H])([2H])OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C11H13BrO2/c12-11-5-3-10(4-6-11)9-14-8-2-1-7-13/h1-6,13H,7-9H2/b2-1+/i1D,2D,8D2 |
| InChIKey | SRHBJWNLCAUJSU-JNNCATETSA-N |
| XLogP | 2.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|