C10H11Br3O — CID 67833437
1-bromo-4-(2,2-dibromopropoxymethyl)benzene (PubChem CID 67833437) has the molecular formula C10H11Br3O and a molecular weight of 386.91 g/mol. Its IUPAC name is 1-bromo-4-(2,2-dibromopropoxymethyl)benzene.
| Compound Name | 1-bromo-4-(2,2-dibromopropoxymethyl)benzene |
|---|---|
| PubChem CID | 67833437 |
| Molecular Formula | C10H11Br3O |
| Molecular Weight | 386.91 g/mol |
| Exact Mass | 383.84 |
| IUPAC Name | 1-bromo-4-(2,2-dibromopropoxymethyl)benzene |
| SMILES | CC(Br)(Br)COCc1ccc(Br)cc1 |
| InChI | InChI=1S/C10H11Br3O/c1-10(12,13)7-14-6-8-2-4-9(11)5-3-8/h2-5H,6-7H2,1H3 |
| InChIKey | MXMSHKAHBHBKCM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.91 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|