C12H16BrClO — CID 65124513
1-[(3-bromo-2,2-dimethylpropoxy)methyl]-4-chlorobenzene (PubChem CID 65124513) has the molecular formula C12H16BrClO and a molecular weight of 291.62 g/mol. Its IUPAC name is 1-[(3-bromo-2,2-dimethylpropoxy)methyl]-4-chlorobenzene.
| Compound Name | 1-[(3-bromo-2,2-dimethylpropoxy)methyl]-4-chlorobenzene |
|---|---|
| PubChem CID | 65124513 |
| Molecular Formula | C12H16BrClO |
| Molecular Weight | 291.62 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 1-[(3-bromo-2,2-dimethylpropoxy)methyl]-4-chlorobenzene |
| SMILES | CC(C)(CBr)COCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H16BrClO/c1-12(2,8-13)9-15-7-10-3-5-11(14)6-4-10/h3-6H,7-9H2,1-2H3 |
| InChIKey | OVWJBOFIAKYSNW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|