About 1-[(4-chlorophenyl)methoxy]-2-(4-methoxyphenyl)-N,N-dimethylpropan-2-amine
1-[(4-chlorophenyl)methoxy]-2-(4-methoxyphenyl)-N,N-dimethylpropan-2-amine (PubChem CID 12926478) has the molecular formula C19H24ClNO2
and a molecular weight of 333.86 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methoxy]-2-(4-methoxyphenyl)-N,N-dimethylpropan-2-amine.
Molecular Properties
| Compound Name | 1-[(4-chlorophenyl)methoxy]-2-(4-methoxyphenyl)-N,N-dimethylpropan-2-amine |
| PubChem CID | 12926478 |
| Molecular Formula | C19H24ClNO2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 1-[(4-chlorophenyl)methoxy]-2-(4-methoxyphenyl)-N,N-dimethylpropan-2-amine |
| SMILES | COc1ccc(C(C)(COCc2ccc(Cl)cc2)N(C)C)cc1 |
| InChI | InChI=1S/C19H24ClNO2/c1-19(21(2)3,16-7-11-18(22-4)12-8-16)14-23-13-15-5-9-17(20)10-6-15/h5-12H,13-14H2,1-4H3 |
| InChIKey | PARCCRLZNVXQRF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(4-chlorophenyl)methoxy]-2-(4-methoxyphenyl)-N,N-dimethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-chlorophenyl)methoxy]-2-(4-methoxyphenyl)-N,N-dimethylpropan-2-amine?
The IUPAC name of 1-[(4-chlorophenyl)methoxy]-2-(4-methoxyphenyl)-N,N-dimethylpropan-2-amine (CID 12926478) is 1-[(4-chlorophenyl)methoxy]-2-(4-methoxyphenyl)-N,N-dimethylpropan-2-amine.
What is the SMILES notation for 1-[(4-chlorophenyl)methoxy]-2-(4-methoxyphenyl)-N,N-dimethylpropan-2-amine?
The canonical SMILES for 1-[(4-chlorophenyl)methoxy]-2-(4-methoxyphenyl)-N,N-dimethylpropan-2-amine is COc1ccc(C(C)(COCc2ccc(Cl)cc2)N(C)C)cc1.
What is the InChIKey of 1-[(4-chlorophenyl)methoxy]-2-(4-methoxyphenyl)-N,N-dimethylpropan-2-amine?
The InChIKey is PARCCRLZNVXQRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24ClNO2/c1-19(21(2)3,16-7-11-18(22-4)12-8-16)14-23-13-15-5-9-17(20)10-6-15/h5-12H,13-14H2,1-4H3.
What are the key properties of 1-[(4-chlorophenyl)methoxy]-2-(4-methoxyphenyl)-N,N-dimethylpropan-2-amine?
1-[(4-chlorophenyl)methoxy]-2-(4-methoxyphenyl)-N,N-dimethylpropan-2-amine has a molecular weight of 333.86 g/mol, XLogP of 4.34, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-chlorophenyl)methoxy]-2-(4-methoxyphenyl)-N,N-dimethylpropan-2-amine is sourced from PubChem (CID 12926478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).