About 1-[(2-methanidyl-2-methylpropoxy)methyl]-4-methoxybenzene;zinc;hydrobromide
1-[(2-methanidyl-2-methylpropoxy)methyl]-4-methoxybenzene;zinc;hydrobromide (PubChem CID 175502067) has the molecular formula C13H20BrO2Zn-
and a molecular weight of 353.60 g/mol. Its IUPAC name is 1-[(2-methanidyl-2-methylpropoxy)methyl]-4-methoxybenzene;zinc;hydrobromide.
Molecular Properties
| Compound Name | 1-[(2-methanidyl-2-methylpropoxy)methyl]-4-methoxybenzene;zinc;hydrobromide |
| PubChem CID | 175502067 |
| Molecular Formula | C13H20BrO2Zn- |
| Molecular Weight | 353.60 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 1-[(2-methanidyl-2-methylpropoxy)methyl]-4-methoxybenzene;zinc;hydrobromide |
| SMILES | Br.[CH2-]C(C)(C)COCc1ccc(OC)cc1.[Zn] |
| InChI | InChI=1S/C13H19O2.BrH.Zn/c1-13(2,3)10-15-9-11-5-7-12(14-4)8-6-11;;/h5-8H,1,9-10H2,2-4H3;1H;/q-1;; |
| InChIKey | JUGIPCSMXISXKU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.60 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-methanidyl-2-methylpropoxy)methyl]-4-methoxybenzene;zinc;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-methanidyl-2-methylpropoxy)methyl]-4-methoxybenzene;zinc;hydrobromide?
The IUPAC name of 1-[(2-methanidyl-2-methylpropoxy)methyl]-4-methoxybenzene;zinc;hydrobromide (CID 175502067) is 1-[(2-methanidyl-2-methylpropoxy)methyl]-4-methoxybenzene;zinc;hydrobromide.
What is the SMILES notation for 1-[(2-methanidyl-2-methylpropoxy)methyl]-4-methoxybenzene;zinc;hydrobromide?
The canonical SMILES for 1-[(2-methanidyl-2-methylpropoxy)methyl]-4-methoxybenzene;zinc;hydrobromide is Br.[CH2-]C(C)(C)COCc1ccc(OC)cc1.[Zn].
What is the InChIKey of 1-[(2-methanidyl-2-methylpropoxy)methyl]-4-methoxybenzene;zinc;hydrobromide?
The InChIKey is JUGIPCSMXISXKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19O2.BrH.Zn/c1-13(2,3)10-15-9-11-5-7-12(14-4)8-6-11;;/h5-8H,1,9-10H2,2-4H3;1H;/q-1;;.
What are the key properties of 1-[(2-methanidyl-2-methylpropoxy)methyl]-4-methoxybenzene;zinc;hydrobromide?
1-[(2-methanidyl-2-methylpropoxy)methyl]-4-methoxybenzene;zinc;hydrobromide has a molecular weight of 353.60 g/mol, XLogP of 3.65, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-methanidyl-2-methylpropoxy)methyl]-4-methoxybenzene;zinc;hydrobromide is sourced from PubChem (CID 175502067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).