C13H21NO4S — CID 64999486
3-[(4-methoxyphenyl)methoxy]-2,2-dimethylpropane-1-sulfonamide (PubChem CID 64999486) has the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methoxy]-2,2-dimethylpropane-1-sulfonamide.
| Compound Name | 3-[(4-methoxyphenyl)methoxy]-2,2-dimethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 64999486 |
| Molecular Formula | C13H21NO4S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 3-[(4-methoxyphenyl)methoxy]-2,2-dimethylpropane-1-sulfonamide |
| SMILES | COc1ccc(COCC(C)(C)CS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H21NO4S/c1-13(2,10-19(14,15)16)9-18-8-11-4-6-12(17-3)7-5-11/h4-7H,8-10H2,1-3H3,(H2,14,15,16) |
| InChIKey | DJNIKVMZXRIAFM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |