About (4-methoxyphenyl)methyl hypobromite
(4-methoxyphenyl)methyl hypobromite (PubChem CID 166766888) has the molecular formula C8H9BrO2
and a molecular weight of 217.06 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl hypobromite.
Molecular Properties
| Compound Name | (4-methoxyphenyl)methyl hypobromite |
| PubChem CID | 166766888 |
| Molecular Formula | C8H9BrO2 |
| Molecular Weight | 217.06 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | (4-methoxyphenyl)methyl hypobromite |
| SMILES | COc1ccc(COBr)cc1 |
| InChI | InChI=1S/C8H9BrO2/c1-10-8-4-2-7(3-5-8)6-11-9/h2-5H,6H2,1H3 |
| InChIKey | LAQKTGSCPSBTBC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.06 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-methoxyphenyl)methyl hypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)methyl hypobromite?
The IUPAC name of (4-methoxyphenyl)methyl hypobromite (CID 166766888) is (4-methoxyphenyl)methyl hypobromite.
What is the SMILES notation for (4-methoxyphenyl)methyl hypobromite?
The canonical SMILES for (4-methoxyphenyl)methyl hypobromite is COc1ccc(COBr)cc1.
What is the InChIKey of (4-methoxyphenyl)methyl hypobromite?
The InChIKey is LAQKTGSCPSBTBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrO2/c1-10-8-4-2-7(3-5-8)6-11-9/h2-5H,6H2,1H3.
What are the key properties of (4-methoxyphenyl)methyl hypobromite?
(4-methoxyphenyl)methyl hypobromite has a molecular weight of 217.06 g/mol, XLogP of 2.52, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)methyl hypobromite is sourced from PubChem (CID 166766888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).