About CID 175604529
CID 175604529 (PubChem CID 175604529) has the molecular formula C8H11OSi
and a molecular weight of 151.26 g/mol.
Molecular Properties
| Compound Name | CID 175604529 |
| PubChem CID | 175604529 |
| Molecular Formula | C8H11OSi |
| Molecular Weight | 151.26 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | — |
| SMILES | COc1ccc(C[SiH2])cc1 |
| InChI | InChI=1S/C8H11OSi/c1-9-8-4-2-7(6-10)3-5-8/h2-5H,6,10H2,1H3 |
| InChIKey | LSIMTYZUVPILOF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175604529 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175604529?
The IUPAC name of CID 175604529 (CID 175604529) is not available.
What is the SMILES notation for CID 175604529?
The canonical SMILES for CID 175604529 is COc1ccc(C[SiH2])cc1.
What is the InChIKey of CID 175604529?
The InChIKey is LSIMTYZUVPILOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11OSi/c1-9-8-4-2-7(6-10)3-5-8/h2-5H,6,10H2,1H3.
What are the key properties of CID 175604529?
CID 175604529 has a molecular weight of 151.26 g/mol, XLogP of 0.83, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175604529 is sourced from PubChem (CID 175604529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).