About (4-bromophenyl)methyl methanimidate
(4-bromophenyl)methyl methanimidate (PubChem CID 143507583) has the molecular formula C8H8BrNO
and a molecular weight of 214.06 g/mol. Its IUPAC name is (4-bromophenyl)methyl methanimidate.
Molecular Properties
| Compound Name | (4-bromophenyl)methyl methanimidate |
| PubChem CID | 143507583 |
| Molecular Formula | C8H8BrNO |
| Molecular Weight | 214.06 g/mol |
| Exact Mass | 212.98 |
| IUPAC Name | (4-bromophenyl)methyl methanimidate |
| SMILES | [H]/N=C/OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C8H8BrNO/c9-8-3-1-7(2-4-8)5-11-6-10/h1-4,6,10H,5H2/b10-6+ |
| InChIKey | HFWYXBSBLCUKGC-UXBLZVDNSA-N |
| XLogP | 2.57 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.06 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl)methyl methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)methyl methanimidate?
The IUPAC name of (4-bromophenyl)methyl methanimidate (CID 143507583) is (4-bromophenyl)methyl methanimidate.
What is the SMILES notation for (4-bromophenyl)methyl methanimidate?
The canonical SMILES for (4-bromophenyl)methyl methanimidate is [H]/N=C/OCc1ccc(Br)cc1.
What is the InChIKey of (4-bromophenyl)methyl methanimidate?
The InChIKey is HFWYXBSBLCUKGC-UXBLZVDNSA-N. The full InChI is InChI=1S/C8H8BrNO/c9-8-3-1-7(2-4-8)5-11-6-10/h1-4,6,10H,5H2/b10-6+.
What are the key properties of (4-bromophenyl)methyl methanimidate?
(4-bromophenyl)methyl methanimidate has a molecular weight of 214.06 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)methyl methanimidate is sourced from PubChem (CID 143507583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).