C17H21BrO5 — CID 10500287
[(2S)-2-[(1R)-1-acetyloxy-2-[(4-bromophenyl)methoxy]ethyl]but-3-enyl] acetate (PubChem CID 10500287) has the molecular formula C17H21BrO5 and a molecular weight of 385.25 g/mol. Its IUPAC name is [(2S)-2-[(1R)-1-acetyloxy-2-[(4-bromophenyl)methoxy]ethyl]but-3-enyl] acetate.
| Compound Name | [(2S)-2-[(1R)-1-acetyloxy-2-[(4-bromophenyl)methoxy]ethyl]but-3-enyl] acetate |
|---|---|
| PubChem CID | 10500287 |
| Molecular Formula | C17H21BrO5 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | [(2S)-2-[(1R)-1-acetyloxy-2-[(4-bromophenyl)methoxy]ethyl]but-3-enyl] acetate |
| SMILES | C=C[C@@H](COC(C)=O)[C@H](COCc1ccc(Br)cc1)OC(C)=O |
| InChI | InChI=1S/C17H21BrO5/c1-4-15(10-22-12(2)19)17(23-13(3)20)11-21-9-14-5-7-16(18)8-6-14/h4-8,15,17H,1,9-11H2,2-3H3/t15-,17-/m0/s1 |
| InChIKey | FSLMEMYECNJESV-RDJZCZTQSA-N |
| XLogP | 3.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|