C21H33BrO4Si — CID 10718662
[(2R,3S)-1-[(4-bromophenyl)methoxy]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pent-4-en-2-yl] acetate (PubChem CID 10718662) has the molecular formula C21H33BrO4Si and a molecular weight of 457.48 g/mol. Its IUPAC name is [(2R,3S)-1-[(4-bromophenyl)methoxy]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pent-4-en-2-yl] acetate.
| Compound Name | [(2R,3S)-1-[(4-bromophenyl)methoxy]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pent-4-en-2-yl] acetate |
|---|---|
| PubChem CID | 10718662 |
| Molecular Formula | C21H33BrO4Si |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | [(2R,3S)-1-[(4-bromophenyl)methoxy]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pent-4-en-2-yl] acetate |
| SMILES | C=C[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](COCc1ccc(Br)cc1)OC(C)=O |
| InChI | InChI=1S/C21H33BrO4Si/c1-8-18(14-25-27(6,7)21(3,4)5)20(26-16(2)23)15-24-13-17-9-11-19(22)12-10-17/h8-12,18,20H,1,13-15H2,2-7H3/t18-,20-/m0/s1 |
| InChIKey | NBYVVSCPXNVHDM-ICSRJNTNSA-N |
| XLogP | 5.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|