C18H30O5Si — CID 19350803
2-[1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropan-2-yl]oxyacetic acid (PubChem CID 19350803) has the molecular formula C18H30O5Si and a molecular weight of 354.52 g/mol. Its IUPAC name is 2-[1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropan-2-yl]oxyacetic acid.
| Compound Name | 2-[1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropan-2-yl]oxyacetic acid |
|---|---|
| PubChem CID | 19350803 |
| Molecular Formula | C18H30O5Si |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-[1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropan-2-yl]oxyacetic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC(COCc1ccccc1)OCC(=O)O |
| InChI | InChI=1S/C18H30O5Si/c1-18(2,3)24(4,5)23-13-16(22-14-17(19)20)12-21-11-15-9-7-6-8-10-15/h6-10,16H,11-14H2,1-5H3,(H,19,20) |
| InChIKey | OSDHZUMHSBCBDW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|