C17H29N3O3Si — CID 10247403
(2R,3S)-3-azido-1-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybutan-2-ol (PubChem CID 10247403) has the molecular formula C17H29N3O3Si and a molecular weight of 351.52 g/mol. Its IUPAC name is (2R,3S)-3-azido-1-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybutan-2-ol.
| Compound Name | (2R,3S)-3-azido-1-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybutan-2-ol |
|---|---|
| PubChem CID | 10247403 |
| Molecular Formula | C17H29N3O3Si |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | (2R,3S)-3-azido-1-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybutan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](O)[C@H](COCc1ccccc1)N=[N+]=[N-] |
| InChI | InChI=1S/C17H29N3O3Si/c1-17(2,3)24(4,5)23-13-16(21)15(19-20-18)12-22-11-14-9-7-6-8-10-14/h6-10,15-16,21H,11-13H2,1-5H3/t15-,16-/m0/s1 |
| InChIKey | MDWSHOGSUXNBKP-HOTGVXAUSA-N |
| XLogP | 4.26 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|