C33H37N3O2Si — CID 101040416
[(2S,3S)-3-azido-2-phenyl-4-phenylmethoxybutoxy]-tert-butyl-diphenylsilane (PubChem CID 101040416) has the molecular formula C33H37N3O2Si and a molecular weight of 535.76 g/mol. Its IUPAC name is [(2S,3S)-3-azido-2-phenyl-4-phenylmethoxybutoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2S,3S)-3-azido-2-phenyl-4-phenylmethoxybutoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 101040416 |
| Molecular Formula | C33H37N3O2Si |
| Molecular Weight | 535.76 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | [(2S,3S)-3-azido-2-phenyl-4-phenylmethoxybutoxy]-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H](c1ccccc1)[C@@H](COCc1ccccc1)N=[N+]=[N-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H37N3O2Si/c1-33(2,3)39(29-20-12-6-13-21-29,30-22-14-7-15-23-30)38-25-31(28-18-10-5-11-19-28)32(35-36-34)26-37-24-27-16-8-4-9-17-27/h4-23,31-32H,24-26H2,1-3H3/t31-,32+/m0/s1 |
| InChIKey | QUEPSRRGZPYSJZ-AJQTZOPKSA-N |
| XLogP | 7.24 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.76 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|