C31H40O4Si — CID 10885655
tert-butyl-[(2S)-2-(oxan-2-yloxy)-3-phenylmethoxypropoxy]-diphenylsilane (PubChem CID 10885655) has the molecular formula C31H40O4Si and a molecular weight of 504.74 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-(oxan-2-yloxy)-3-phenylmethoxypropoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S)-2-(oxan-2-yloxy)-3-phenylmethoxypropoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10885655 |
| Molecular Formula | C31H40O4Si |
| Molecular Weight | 504.74 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | tert-butyl-[(2S)-2-(oxan-2-yloxy)-3-phenylmethoxypropoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@H](COCc1ccccc1)OC1CCCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H40O4Si/c1-31(2,3)36(28-17-9-5-10-18-28,29-19-11-6-12-20-29)34-25-27(35-30-21-13-14-22-33-30)24-32-23-26-15-7-4-8-16-26/h4-12,15-20,27,30H,13-14,21-25H2,1-3H3/t27-,30?/m0/s1 |
| InChIKey | KOYXTYHFZSYGEN-CEBUJLNPSA-N |
| XLogP | 5.69 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.74 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|