C35H44O5Si — CID 10918855
tert-butyl-[(2S)-1-[(4-methoxyphenyl)methoxy]-6-(oxan-2-yloxy)hex-4-yn-2-yl]oxy-diphenylsilane (PubChem CID 10918855) has the molecular formula C35H44O5Si and a molecular weight of 572.82 g/mol. Its IUPAC name is tert-butyl-[(2S)-1-[(4-methoxyphenyl)methoxy]-6-(oxan-2-yloxy)hex-4-yn-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2S)-1-[(4-methoxyphenyl)methoxy]-6-(oxan-2-yloxy)hex-4-yn-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 10918855 |
| Molecular Formula | C35H44O5Si |
| Molecular Weight | 572.82 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | tert-butyl-[(2S)-1-[(4-methoxyphenyl)methoxy]-6-(oxan-2-yloxy)hex-4-yn-2-yl]oxy-diphenylsilane |
| SMILES | COc1ccc(COC[C@H](CC#CCOC2CCCCO2)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C35H44O5Si/c1-35(2,3)41(32-16-7-5-8-17-32,33-18-9-6-10-19-33)40-31(15-11-13-25-38-34-20-12-14-26-39-34)28-37-27-29-21-23-30(36-4)24-22-29/h5-10,16-19,21-24,31,34H,12,14-15,20,25-28H2,1-4H3/t31-,34?/m0/s1 |
| InChIKey | GKRYLAWOAPNPGY-PTYUOYDSSA-N |
| XLogP | 6.09 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.82 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|