C42H62O5Si2 — CID 166444797
(2S,3Z,5S,6Z,11S)-11-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]dodeca-3,6-dien-5-ol (PubChem CID 166444797) has the molecular formula C42H62O5Si2 and a molecular weight of 703.13 g/mol. Its IUPAC name is (2S,3Z,5S,6Z,11S)-11-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]dodeca-3,6-dien-5-ol.
| Compound Name | (2S,3Z,5S,6Z,11S)-11-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]dodeca-3,6-dien-5-ol |
|---|---|
| PubChem CID | 166444797 |
| Molecular Formula | C42H62O5Si2 |
| Molecular Weight | 703.13 g/mol |
| Exact Mass | 702.41 |
| IUPAC Name | (2S,3Z,5S,6Z,11S)-11-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]dodeca-3,6-dien-5-ol |
| SMILES | COc1ccc(COC[C@H](/C=C\[C@@H](O)/C=C\CCC[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C42H62O5Si2/c1-34(46-48(9,10)41(2,3)4)20-14-11-15-21-36(43)28-31-38(33-45-32-35-26-29-37(44-8)30-27-35)47-49(42(5,6)7,39-22-16-12-17-23-39)40-24-18-13-19-25-40/h12-13,15-19,21-31,34,36,38,43H,11,14,20,32-33H2,1-10H3/b21-15-,31-28-/t34-,36-,38-/m0/s1 |
| InChIKey | XHTKWAQCMNJIBE-YAAKSFHZSA-N |
| XLogP | 9.21 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.13 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|