C39H52O4Si — CID 10793853
tert-butyl-[(2S)-1-[(4E,6E,8E)-dodeca-4,6,8-trienoxy]-3-[(4-methoxyphenyl)methoxy]propan-2-yl]oxy-diphenylsilane (PubChem CID 10793853) has the molecular formula C39H52O4Si and a molecular weight of 612.93 g/mol. Its IUPAC name is tert-butyl-[(2S)-1-[(4E,6E,8E)-dodeca-4,6,8-trienoxy]-3-[(4-methoxyphenyl)methoxy]propan-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2S)-1-[(4E,6E,8E)-dodeca-4,6,8-trienoxy]-3-[(4-methoxyphenyl)methoxy]propan-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 10793853 |
| Molecular Formula | C39H52O4Si |
| Molecular Weight | 612.93 g/mol |
| Exact Mass | 612.36 |
| IUPAC Name | tert-butyl-[(2S)-1-[(4E,6E,8E)-dodeca-4,6,8-trienoxy]-3-[(4-methoxyphenyl)methoxy]propan-2-yl]oxy-diphenylsilane |
| SMILES | CCC/C=C/C=C/C=C/CCCOC[C@@H](COCc1ccc(OC)cc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C39H52O4Si/c1-6-7-8-9-10-11-12-13-14-21-30-41-32-36(33-42-31-34-26-28-35(40-5)29-27-34)43-44(39(2,3)4,37-22-17-15-18-23-37)38-24-19-16-20-25-38/h8-13,15-20,22-29,36H,6-7,14,21,30-33H2,1-5H3/b9-8+,11-10+,13-12+/t36-/m0/s1 |
| InChIKey | IJCVKYLMKJMZLR-CIOYSZNJSA-N |
| XLogP | 8.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.93 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|