C19H26O4 — CID 72700869
ethyl (2E,4E)-9-[(4-methoxyphenyl)methoxy]nona-2,4-dienoate (PubChem CID 72700869) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is ethyl (2E,4E)-9-[(4-methoxyphenyl)methoxy]nona-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-9-[(4-methoxyphenyl)methoxy]nona-2,4-dienoate |
|---|---|
| PubChem CID | 72700869 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | ethyl (2E,4E)-9-[(4-methoxyphenyl)methoxy]nona-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C/CCCCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H26O4/c1-3-23-19(20)10-8-6-4-5-7-9-15-22-16-17-11-13-18(21-2)14-12-17/h4,6,8,10-14H,3,5,7,9,15-16H2,1-2H3/b6-4+,10-8+ |
| InChIKey | PVIREHFKHUGWCF-ONNLMXTPSA-N |
| XLogP | 4.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|