C17H21IO4 — CID 24900139
ethyl (2E,4Z)-4-iodo-7-[(4-methoxyphenyl)methoxy]hepta-2,4-dienoate (PubChem CID 24900139) has the molecular formula C17H21IO4 and a molecular weight of 416.26 g/mol. Its IUPAC name is ethyl (2E,4Z)-4-iodo-7-[(4-methoxyphenyl)methoxy]hepta-2,4-dienoate.
| Compound Name | ethyl (2E,4Z)-4-iodo-7-[(4-methoxyphenyl)methoxy]hepta-2,4-dienoate |
|---|---|
| PubChem CID | 24900139 |
| Molecular Formula | C17H21IO4 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | ethyl (2E,4Z)-4-iodo-7-[(4-methoxyphenyl)methoxy]hepta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C(I)=C/CCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C17H21IO4/c1-3-22-17(19)11-8-15(18)5-4-12-21-13-14-6-9-16(20-2)10-7-14/h5-11H,3-4,12-13H2,1-2H3/b11-8+,15-5- |
| InChIKey | RIIZISFQXSMQHK-OZJHTJTQSA-N |
| XLogP | 4.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|