C19H28O5 — CID 134944528
ethyl (E,5R)-5-hydroxy-7-[(4-methoxyphenyl)methoxy]-6,6-dimethylhept-2-enoate (PubChem CID 134944528) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is ethyl (E,5R)-5-hydroxy-7-[(4-methoxyphenyl)methoxy]-6,6-dimethylhept-2-enoate.
| Compound Name | ethyl (E,5R)-5-hydroxy-7-[(4-methoxyphenyl)methoxy]-6,6-dimethylhept-2-enoate |
|---|---|
| PubChem CID | 134944528 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | ethyl (E,5R)-5-hydroxy-7-[(4-methoxyphenyl)methoxy]-6,6-dimethylhept-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@@H](O)C(C)(C)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H28O5/c1-5-24-18(21)8-6-7-17(20)19(2,3)14-23-13-15-9-11-16(22-4)12-10-15/h6,8-12,17,20H,5,7,13-14H2,1-4H3/b8-6+/t17-/m1/s1 |
| InChIKey | YNDYZRDHBTZNDF-DBWMJRBXSA-N |
| XLogP | 3.11 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|