C30H48O7Si — CID 24756277
[(E,2R)-6-ethoxy-6-oxohex-4-en-2-yl] (E,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]oct-2-enoate (PubChem CID 24756277) has the molecular formula C30H48O7Si and a molecular weight of 548.79 g/mol. Its IUPAC name is [(E,2R)-6-ethoxy-6-oxohex-4-en-2-yl] (E,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]oct-2-enoate.
| Compound Name | [(E,2R)-6-ethoxy-6-oxohex-4-en-2-yl] (E,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]oct-2-enoate |
|---|---|
| PubChem CID | 24756277 |
| Molecular Formula | C30H48O7Si |
| Molecular Weight | 548.79 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | [(E,2R)-6-ethoxy-6-oxohex-4-en-2-yl] (E,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]oct-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@@H](C)OC(=O)/C=C/C[C@@H](C[C@@H](C)OCc1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H48O7Si/c1-10-34-28(31)15-11-13-23(2)36-29(32)16-12-14-27(37-38(8,9)30(4,5)6)21-24(3)35-22-25-17-19-26(33-7)20-18-25/h11-12,15-20,23-24,27H,10,13-14,21-22H2,1-9H3/b15-11+,16-12+/t23-,24-,27+/m1/s1 |
| InChIKey | OPAVFUFMQZTSMA-MJAZXQLXSA-N |
| XLogP | 6.77 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.79 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|