C29H50O9Si — CID 45101568
ethyl (Z,5R,7R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-7,8-bis(methoxymethoxy)-9-[(4-methoxyphenyl)methoxy]non-2-enoate (PubChem CID 45101568) has the molecular formula C29H50O9Si and a molecular weight of 570.80 g/mol. Its IUPAC name is ethyl (Z,5R,7R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-7,8-bis(methoxymethoxy)-9-[(4-methoxyphenyl)methoxy]non-2-enoate.
| Compound Name | ethyl (Z,5R,7R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-7,8-bis(methoxymethoxy)-9-[(4-methoxyphenyl)methoxy]non-2-enoate |
|---|---|
| PubChem CID | 45101568 |
| Molecular Formula | C29H50O9Si |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | ethyl (Z,5R,7R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-7,8-bis(methoxymethoxy)-9-[(4-methoxyphenyl)methoxy]non-2-enoate |
| SMILES | CCOC(=O)/C=C\C[C@H](C[C@@H](OCOC)[C@@H](COCc1ccc(OC)cc1)OCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H50O9Si/c1-10-35-28(30)13-11-12-25(38-39(8,9)29(2,3)4)18-26(36-21-31-5)27(37-22-32-6)20-34-19-23-14-16-24(33-7)17-15-23/h11,13-17,25-27H,10,12,18-22H2,1-9H3/b13-11-/t25-,26-,27-/m1/s1 |
| InChIKey | PKTAZDWODPHUMV-SHEHZFBWSA-N |
| XLogP | 5.48 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|