C16H22O4 — CID 11140421
ethyl (E)-5-hydroxy-7-phenylmethoxyhept-2-enoate (PubChem CID 11140421) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is ethyl (E)-5-hydroxy-7-phenylmethoxyhept-2-enoate.
| Compound Name | ethyl (E)-5-hydroxy-7-phenylmethoxyhept-2-enoate |
|---|---|
| PubChem CID | 11140421 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | ethyl (E)-5-hydroxy-7-phenylmethoxyhept-2-enoate |
| SMILES | CCOC(=O)/C=C/CC(O)CCOCc1ccccc1 |
| InChI | InChI=1S/C16H22O4/c1-2-20-16(18)10-6-9-15(17)11-12-19-13-14-7-4-3-5-8-14/h3-8,10,15,17H,2,9,11-13H2,1H3/b10-6+ |
| InChIKey | SGWGQKIQARQCOC-UXBLZVDNSA-N |
| XLogP | 2.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|