C22H34O5 — CID 11559909
tert-butyl (E,3R,7R)-3,7-dihydroxy-2,2-dimethyl-9-phenylmethoxynon-4-enoate (PubChem CID 11559909) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is tert-butyl (E,3R,7R)-3,7-dihydroxy-2,2-dimethyl-9-phenylmethoxynon-4-enoate.
| Compound Name | tert-butyl (E,3R,7R)-3,7-dihydroxy-2,2-dimethyl-9-phenylmethoxynon-4-enoate |
|---|---|
| PubChem CID | 11559909 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | tert-butyl (E,3R,7R)-3,7-dihydroxy-2,2-dimethyl-9-phenylmethoxynon-4-enoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)[C@H](O)/C=C/C[C@@H](O)CCOCc1ccccc1 |
| InChI | InChI=1S/C22H34O5/c1-21(2,3)27-20(25)22(4,5)19(24)13-9-12-18(23)14-15-26-16-17-10-7-6-8-11-17/h6-11,13,18-19,23-24H,12,14-16H2,1-5H3/b13-9+/t18-,19-/m1/s1 |
| InChIKey | TZXXXAMHYUKYBN-OBIQQPLYSA-N |
| XLogP | 3.63 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|