C17H24O4 — CID 101420262
ethyl (E,4S,5R)-5-hydroxy-4-methyl-7-phenylmethoxyhept-2-enoate (PubChem CID 101420262) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is ethyl (E,4S,5R)-5-hydroxy-4-methyl-7-phenylmethoxyhept-2-enoate.
| Compound Name | ethyl (E,4S,5R)-5-hydroxy-4-methyl-7-phenylmethoxyhept-2-enoate |
|---|---|
| PubChem CID | 101420262 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | ethyl (E,4S,5R)-5-hydroxy-4-methyl-7-phenylmethoxyhept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](C)[C@H](O)CCOCc1ccccc1 |
| InChI | InChI=1S/C17H24O4/c1-3-21-17(19)10-9-14(2)16(18)11-12-20-13-15-7-5-4-6-8-15/h4-10,14,16,18H,3,11-13H2,1-2H3/b10-9+/t14-,16+/m0/s1 |
| InChIKey | NIRFFOHZKBDHGP-KTMLPXRHSA-N |
| XLogP | 2.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|