C26H34O7 — CID 102262678
4-O-ethyl 1-O,1-O-bis(prop-2-enyl) (E,2S)-2-(4-phenylmethoxybutyl)but-3-ene-1,1,4-tricarboxylate (PubChem CID 102262678) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is 4-O-ethyl 1-O,1-O-bis(prop-2-enyl) (E,2S)-2-(4-phenylmethoxybutyl)but-3-ene-1,1,4-tricarboxylate.
| Compound Name | 4-O-ethyl 1-O,1-O-bis(prop-2-enyl) (E,2S)-2-(4-phenylmethoxybutyl)but-3-ene-1,1,4-tricarboxylate |
|---|---|
| PubChem CID | 102262678 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 4-O-ethyl 1-O,1-O-bis(prop-2-enyl) (E,2S)-2-(4-phenylmethoxybutyl)but-3-ene-1,1,4-tricarboxylate |
| SMILES | C=CCOC(=O)C(C(=O)OCC=C)[C@H](/C=C/C(=O)OCC)CCCCOCc1ccccc1 |
| InChI | InChI=1S/C26H34O7/c1-4-17-32-25(28)24(26(29)33-18-5-2)22(15-16-23(27)31-6-3)14-10-11-19-30-20-21-12-8-7-9-13-21/h4-5,7-9,12-13,15-16,22,24H,1-2,6,10-11,14,17-20H2,3H3/b16-15+/t22-/m0/s1 |
| InChIKey | NEXVGPLCDPDNHE-BQXQKYNTSA-N |
| XLogP | 4.18 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|