C31H44O11 — CID 131987465
ethyl 3-[2,2-bis[(3-ethoxy-3-oxoprop-1-enoxy)methyl]-3-(4-phenylmethoxybutoxy)propoxy]prop-2-enoate (PubChem CID 131987465) has the molecular formula C31H44O11 and a molecular weight of 592.68 g/mol. Its IUPAC name is ethyl 3-[2,2-bis[(3-ethoxy-3-oxoprop-1-enoxy)methyl]-3-(4-phenylmethoxybutoxy)propoxy]prop-2-enoate.
| Compound Name | ethyl 3-[2,2-bis[(3-ethoxy-3-oxoprop-1-enoxy)methyl]-3-(4-phenylmethoxybutoxy)propoxy]prop-2-enoate |
|---|---|
| PubChem CID | 131987465 |
| Molecular Formula | C31H44O11 |
| Molecular Weight | 592.68 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | ethyl 3-[2,2-bis[(3-ethoxy-3-oxoprop-1-enoxy)methyl]-3-(4-phenylmethoxybutoxy)propoxy]prop-2-enoate |
| SMILES | CCOC(=O)C=COCC(COC=CC(=O)OCC)(COC=CC(=O)OCC)COCCCCOCc1ccccc1 |
| InChI | InChI=1S/C31H44O11/c1-4-40-28(32)14-19-37-24-31(25-38-20-15-29(33)41-5-2,26-39-21-16-30(34)42-6-3)23-36-18-11-10-17-35-22-27-12-8-7-9-13-27/h7-9,12-16,19-21H,4-6,10-11,17-18,22-26H2,1-3H3 |
| InChIKey | DHTURMIUOQWFFN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.68 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|