C23H34O5 — CID 10475514
diethyl 2-[(2R)-6-phenylmethoxy-2-prop-2-enylhexyl]propanedioate (PubChem CID 10475514) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is diethyl 2-[(2R)-6-phenylmethoxy-2-prop-2-enylhexyl]propanedioate.
| Compound Name | diethyl 2-[(2R)-6-phenylmethoxy-2-prop-2-enylhexyl]propanedioate |
|---|---|
| PubChem CID | 10475514 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | diethyl 2-[(2R)-6-phenylmethoxy-2-prop-2-enylhexyl]propanedioate |
| SMILES | C=CC[C@@H](CCCCOCc1ccccc1)CC(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C23H34O5/c1-4-12-19(17-21(22(24)27-5-2)23(25)28-6-3)13-10-11-16-26-18-20-14-8-7-9-15-20/h4,7-9,14-15,19,21H,1,5-6,10-13,16-18H2,2-3H3/t19-/m0/s1 |
| InChIKey | QIQNVWAVZMSLOD-IBGZPJMESA-N |
| XLogP | 4.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|