C15H21NO2 — CID 125470309
ethyl N-[(2S)-2-benzylpent-4-enyl]carbamate (PubChem CID 125470309) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is ethyl N-[(2S)-2-benzylpent-4-enyl]carbamate.
| Compound Name | ethyl N-[(2S)-2-benzylpent-4-enyl]carbamate |
|---|---|
| PubChem CID | 125470309 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | ethyl N-[(2S)-2-benzylpent-4-enyl]carbamate |
| SMILES | C=CCC(CNC(=O)OCC)Cc1ccccc1 |
| InChI | InChI=1S/C15H21NO2/c1-3-8-14(12-16-15(17)18-4-2)11-13-9-6-5-7-10-13/h3,5-7,9-10,14H,1,4,8,11-12H2,2H3,(H,16,17) |
| InChIKey | FDEWPILIPHWXDN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|