C24H38O6 — CID 102457430
ditert-butyl 2-[(2R)-2-(hydroxymethyl)-5-phenylmethoxypentyl]propanedioate (PubChem CID 102457430) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is ditert-butyl 2-[(2R)-2-(hydroxymethyl)-5-phenylmethoxypentyl]propanedioate.
| Compound Name | ditert-butyl 2-[(2R)-2-(hydroxymethyl)-5-phenylmethoxypentyl]propanedioate |
|---|---|
| PubChem CID | 102457430 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | ditert-butyl 2-[(2R)-2-(hydroxymethyl)-5-phenylmethoxypentyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(C[C@H](CO)CCCOCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38O6/c1-23(2,3)29-21(26)20(22(27)30-24(4,5)6)15-19(16-25)13-10-14-28-17-18-11-8-7-9-12-18/h7-9,11-12,19-20,25H,10,13-17H2,1-6H3/t19-/m1/s1 |
| InChIKey | YECJXFYGHJWBQH-LJQANCHMSA-N |
| XLogP | 4.28 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|