C20H31NO6 — CID 101384316
ethyl (2R,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxyhexanoate (PubChem CID 101384316) has the molecular formula C20H31NO6 and a molecular weight of 381.47 g/mol. Its IUPAC name is ethyl (2R,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxyhexanoate.
| Compound Name | ethyl (2R,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxyhexanoate |
|---|---|
| PubChem CID | 101384316 |
| Molecular Formula | C20H31NO6 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | ethyl (2R,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxyhexanoate |
| SMILES | CCOC(=O)[C@H](NC(=O)OC(C)(C)C)[C@H](O)CCCOCc1ccccc1 |
| InChI | InChI=1S/C20H31NO6/c1-5-26-18(23)17(21-19(24)27-20(2,3)4)16(22)12-9-13-25-14-15-10-7-6-8-11-15/h6-8,10-11,16-17,22H,5,9,12-14H2,1-4H3,(H,21,24)/t16-,17-/m1/s1 |
| InChIKey | LUHWSRUIUQSQFA-IAGOWNOFSA-N |
| XLogP | 2.80 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|