C19H29NO4 — CID 165464633
tert-butyl N-[(3S)-4-oxo-7-phenylmethoxyheptan-3-yl]carbamate (PubChem CID 165464633) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is tert-butyl N-[(3S)-4-oxo-7-phenylmethoxyheptan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-4-oxo-7-phenylmethoxyheptan-3-yl]carbamate |
|---|---|
| PubChem CID | 165464633 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | tert-butyl N-[(3S)-4-oxo-7-phenylmethoxyheptan-3-yl]carbamate |
| SMILES | CC[C@H](NC(=O)OC(C)(C)C)C(=O)CCCOCc1ccccc1 |
| InChI | InChI=1S/C19H29NO4/c1-5-16(20-18(22)24-19(2,3)4)17(21)12-9-13-23-14-15-10-7-6-8-11-15/h6-8,10-11,16H,5,9,12-14H2,1-4H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | IOZONGSMKIHBMQ-INIZCTEOSA-N |
| XLogP | 3.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|