C19H29NO4 — CID 162117321
benzene;tert-butyl N-[(3S)-4,7-dioxooctan-3-yl]carbamate (PubChem CID 162117321) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is benzene;tert-butyl N-[(3S)-4,7-dioxooctan-3-yl]carbamate.
| Compound Name | benzene;tert-butyl N-[(3S)-4,7-dioxooctan-3-yl]carbamate |
|---|---|
| PubChem CID | 162117321 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | benzene;tert-butyl N-[(3S)-4,7-dioxooctan-3-yl]carbamate |
| SMILES | CC[C@H](NC(=O)OC(C)(C)C)C(=O)CCC(C)=O.c1ccccc1 |
| InChI | InChI=1S/C13H23NO4.C6H6/c1-6-10(11(16)8-7-9(2)15)14-12(17)18-13(3,4)5;1-2-4-6-5-3-1/h10H,6-8H2,1-5H3,(H,14,17);1-6H/t10-;/m0./s1 |
| InChIKey | ZGYBYGBWOMANHD-PPHPATTJSA-N |
| XLogP | 3.91 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |