C12H21NO4 — CID 58195942
tert-butyl N-[(2S)-3,6-dioxoheptan-2-yl]carbamate (PubChem CID 58195942) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3,6-dioxoheptan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3,6-dioxoheptan-2-yl]carbamate |
|---|---|
| PubChem CID | 58195942 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | tert-butyl N-[(2S)-3,6-dioxoheptan-2-yl]carbamate |
| SMILES | CC(=O)CCC(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21NO4/c1-8(14)6-7-10(15)9(2)13-11(16)17-12(3,4)5/h9H,6-7H2,1-5H3,(H,13,16)/t9-/m0/s1 |
| InChIKey | BWKWRWCDAPOFJP-VIFPVBQESA-N |
| XLogP | 1.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |