C35H51NO7 — CID 131734509
ditert-butyl (2S,4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[[4-(3-phenylmethoxypropyl)phenyl]methyl]pentanedioate (PubChem CID 131734509) has the molecular formula C35H51NO7 and a molecular weight of 597.79 g/mol. Its IUPAC name is ditert-butyl (2S,4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[[4-(3-phenylmethoxypropyl)phenyl]methyl]pentanedioate.
| Compound Name | ditert-butyl (2S,4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[[4-(3-phenylmethoxypropyl)phenyl]methyl]pentanedioate |
|---|---|
| PubChem CID | 131734509 |
| Molecular Formula | C35H51NO7 |
| Molecular Weight | 597.79 g/mol |
| Exact Mass | 597.37 |
| IUPAC Name | ditert-butyl (2S,4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[[4-(3-phenylmethoxypropyl)phenyl]methyl]pentanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C[C@H](Cc1ccc(CCCOCc2ccccc2)cc1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H51NO7/c1-33(2,3)41-30(37)28(23-29(31(38)42-34(4,5)6)36-32(39)43-35(7,8)9)22-26-19-17-25(18-20-26)16-13-21-40-24-27-14-11-10-12-15-27/h10-12,14-15,17-20,28-29H,13,16,21-24H2,1-9H3,(H,36,39)/t28-,29-/m0/s1 |
| InChIKey | AKIAXMWIVWYXKQ-VMPREFPWSA-N |
| XLogP | 6.96 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.79 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|