C27H36N2O7 — CID 70977957
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[[4-(2-phenylmethoxyethylamino)phenyl]methyl]hexanedioic acid (PubChem CID 70977957) has the molecular formula C27H36N2O7 and a molecular weight of 500.59 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[[4-(2-phenylmethoxyethylamino)phenyl]methyl]hexanedioic acid.
| Compound Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[[4-(2-phenylmethoxyethylamino)phenyl]methyl]hexanedioic acid |
|---|---|
| PubChem CID | 70977957 |
| Molecular Formula | C27H36N2O7 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[[4-(2-phenylmethoxyethylamino)phenyl]methyl]hexanedioic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(Cc1ccc(NCCOCc2ccccc2)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C27H36N2O7/c1-27(2,3)36-26(34)29-23(25(32)33)14-11-21(24(30)31)17-19-9-12-22(13-10-19)28-15-16-35-18-20-7-5-4-6-8-20/h4-10,12-13,21,23,28H,11,14-18H2,1-3H3,(H,29,34)(H,30,31)(H,32,33)/t21?,23-/m0/s1 |
| InChIKey | ASXAPIYXGHIVPN-YANBTOMASA-N |
| XLogP | 4.32 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|