C28H37NO6 — CID 139260871
dibenzyl 2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]propanedioate (PubChem CID 139260871) has the molecular formula C28H37NO6 and a molecular weight of 483.61 g/mol. Its IUPAC name is dibenzyl 2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]propanedioate.
| Compound Name | dibenzyl 2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]propanedioate |
|---|---|
| PubChem CID | 139260871 |
| Molecular Formula | C28H37NO6 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | dibenzyl 2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]propanedioate |
| SMILES | CCCCC[C@H](NC(=O)OC(C)(C)C)C(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H37NO6/c1-5-6-9-18-23(29-27(32)35-28(2,3)4)24(25(30)33-19-21-14-10-7-11-15-21)26(31)34-20-22-16-12-8-13-17-22/h7-8,10-17,23-24H,5-6,9,18-20H2,1-4H3,(H,29,32)/t23-/m0/s1 |
| InChIKey | VSLRASBAZXOFPR-QHCPKHFHSA-N |
| XLogP | 5.56 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|