C15H23NO4 — CID 71433233
tert-butyl (2S)-3-amino-2-hydroxy-4-phenylmethoxybutanoate (PubChem CID 71433233) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is tert-butyl (2S)-3-amino-2-hydroxy-4-phenylmethoxybutanoate.
| Compound Name | tert-butyl (2S)-3-amino-2-hydroxy-4-phenylmethoxybutanoate |
|---|---|
| PubChem CID | 71433233 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | tert-butyl (2S)-3-amino-2-hydroxy-4-phenylmethoxybutanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](O)C(N)COCc1ccccc1 |
| InChI | InChI=1S/C15H23NO4/c1-15(2,3)20-14(18)13(17)12(16)10-19-9-11-7-5-4-6-8-11/h4-8,12-13,17H,9-10,16H2,1-3H3/t12?,13-/m0/s1 |
| InChIKey | OJAUTDVRAWADQF-ABLWVSNPSA-N |
| XLogP | 1.23 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |