C17H24O3 — CID 101237570
(2S)-3,3-dimethyl-2-(3-phenylmethoxypropyl)pent-4-enoic acid (PubChem CID 101237570) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-(3-phenylmethoxypropyl)pent-4-enoic acid.
| Compound Name | (2S)-3,3-dimethyl-2-(3-phenylmethoxypropyl)pent-4-enoic acid |
|---|---|
| PubChem CID | 101237570 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (2S)-3,3-dimethyl-2-(3-phenylmethoxypropyl)pent-4-enoic acid |
| SMILES | C=CC(C)(C)[C@H](CCCOCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H24O3/c1-4-17(2,3)15(16(18)19)11-8-12-20-13-14-9-6-5-7-10-14/h4-7,9-10,15H,1,8,11-13H2,2-3H3,(H,18,19)/t15-/m1/s1 |
| InChIKey | RDWBHMCKORZUSF-OAHLLOKOSA-N |
| XLogP | 3.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|