C21H32O5 — CID 11132255
ethyl (E,4S,5S,6S,7R,8R)-5,7-dihydroxy-4,6,8-trimethyl-9-phenylmethoxynon-2-enoate (PubChem CID 11132255) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is ethyl (E,4S,5S,6S,7R,8R)-5,7-dihydroxy-4,6,8-trimethyl-9-phenylmethoxynon-2-enoate.
| Compound Name | ethyl (E,4S,5S,6S,7R,8R)-5,7-dihydroxy-4,6,8-trimethyl-9-phenylmethoxynon-2-enoate |
|---|---|
| PubChem CID | 11132255 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | ethyl (E,4S,5S,6S,7R,8R)-5,7-dihydroxy-4,6,8-trimethyl-9-phenylmethoxynon-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](C)[C@H](O)[C@H](C)[C@H](O)[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C21H32O5/c1-5-26-19(22)12-11-15(2)20(23)17(4)21(24)16(3)13-25-14-18-9-7-6-8-10-18/h6-12,15-17,20-21,23-24H,5,13-14H2,1-4H3/b12-11+/t15-,16+,17-,20-,21+/m0/s1 |
| InChIKey | KPDRYIZAUKERRD-NEULOOAJSA-N |
| XLogP | 2.95 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|