C14H20O4 — CID 102572209
(2S,3R,4S)-3-hydroxy-2,4-dimethyl-5-phenylmethoxypentanoic acid (PubChem CID 102572209) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (2S,3R,4S)-3-hydroxy-2,4-dimethyl-5-phenylmethoxypentanoic acid.
| Compound Name | (2S,3R,4S)-3-hydroxy-2,4-dimethyl-5-phenylmethoxypentanoic acid |
|---|---|
| PubChem CID | 102572209 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (2S,3R,4S)-3-hydroxy-2,4-dimethyl-5-phenylmethoxypentanoic acid |
| SMILES | C[C@H](C(=O)O)[C@H](O)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C14H20O4/c1-10(13(15)11(2)14(16)17)8-18-9-12-6-4-3-5-7-12/h3-7,10-11,13,15H,8-9H2,1-2H3,(H,16,17)/t10-,11-,13+/m0/s1 |
| InChIKey | XEQGKKHKACMSKL-GMXVVIOVSA-N |
| XLogP | 1.92 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |