C16H22O2 — CID 71414407
(2R,3S,4R)-2,4-dimethyl-1-phenylmethoxyhept-5-yn-3-ol (PubChem CID 71414407) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (2R,3S,4R)-2,4-dimethyl-1-phenylmethoxyhept-5-yn-3-ol.
| Compound Name | (2R,3S,4R)-2,4-dimethyl-1-phenylmethoxyhept-5-yn-3-ol |
|---|---|
| PubChem CID | 71414407 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (2R,3S,4R)-2,4-dimethyl-1-phenylmethoxyhept-5-yn-3-ol |
| SMILES | CC#C[C@@H](C)[C@H](O)[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C16H22O2/c1-4-8-13(2)16(17)14(3)11-18-12-15-9-6-5-7-10-15/h5-7,9-10,13-14,16-17H,11-12H2,1-3H3/t13-,14-,16+/m1/s1 |
| InChIKey | VLKSACLQTKQHMA-FMKPAKJESA-N |
| XLogP | 2.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|