C18H24O4 — CID 15122143
[(4S,5R,6R)-5-hydroxy-4,6-dimethyl-7-phenylmethoxyhept-2-ynyl] acetate (PubChem CID 15122143) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is [(4S,5R,6R)-5-hydroxy-4,6-dimethyl-7-phenylmethoxyhept-2-ynyl] acetate.
| Compound Name | [(4S,5R,6R)-5-hydroxy-4,6-dimethyl-7-phenylmethoxyhept-2-ynyl] acetate |
|---|---|
| PubChem CID | 15122143 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | [(4S,5R,6R)-5-hydroxy-4,6-dimethyl-7-phenylmethoxyhept-2-ynyl] acetate |
| SMILES | CC(=O)OCC#C[C@H](C)[C@@H](O)[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C18H24O4/c1-14(8-7-11-22-16(3)19)18(20)15(2)12-21-13-17-9-5-4-6-10-17/h4-6,9-10,14-15,18,20H,11-13H2,1-3H3/t14-,15+,18+/m0/s1 |
| InChIKey | GEPYVHSVPVVUTM-HDMKZQKVSA-N |
| XLogP | 2.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|