C17H24O4 — CID 10039995
[(2S,5S)-2,5-dimethyl-4-oxo-6-phenylmethoxyhexyl] acetate (PubChem CID 10039995) has the molecular formula C17H24O4 and a molecular weight of 292.37 g/mol. Its IUPAC name is [(2S,5S)-2,5-dimethyl-4-oxo-6-phenylmethoxyhexyl] acetate.
| Compound Name | [(2S,5S)-2,5-dimethyl-4-oxo-6-phenylmethoxyhexyl] acetate |
|---|---|
| PubChem CID | 10039995 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [(2S,5S)-2,5-dimethyl-4-oxo-6-phenylmethoxyhexyl] acetate |
| SMILES | CC(=O)OC[C@@H](C)CC(=O)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C17H24O4/c1-13(10-21-15(3)18)9-17(19)14(2)11-20-12-16-7-5-4-6-8-16/h4-8,13-14H,9-12H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | WFLPXDKWCHDBJE-KBPBESRZSA-N |
| XLogP | 3.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |