C18H26O4 — CID 16751296
[(Z,5R,6R)-5-hydroxy-3,6-dimethyl-7-phenylmethoxyhept-2-enyl] acetate (PubChem CID 16751296) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is [(Z,5R,6R)-5-hydroxy-3,6-dimethyl-7-phenylmethoxyhept-2-enyl] acetate.
| Compound Name | [(Z,5R,6R)-5-hydroxy-3,6-dimethyl-7-phenylmethoxyhept-2-enyl] acetate |
|---|---|
| PubChem CID | 16751296 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | [(Z,5R,6R)-5-hydroxy-3,6-dimethyl-7-phenylmethoxyhept-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(/C)C[C@@H](O)[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C18H26O4/c1-14(9-10-22-16(3)19)11-18(20)15(2)12-21-13-17-7-5-4-6-8-17/h4-9,15,18,20H,10-13H2,1-3H3/b14-9-/t15-,18-/m1/s1 |
| InChIKey | FCTKZLHYNJDIKM-MJYCDUKWSA-N |
| XLogP | 3.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|