C14H20O3 — CID 102174023
(E,5S)-3-methyl-6-phenylmethoxyhex-2-ene-1,5-diol (PubChem CID 102174023) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (E,5S)-3-methyl-6-phenylmethoxyhex-2-ene-1,5-diol.
| Compound Name | (E,5S)-3-methyl-6-phenylmethoxyhex-2-ene-1,5-diol |
|---|---|
| PubChem CID | 102174023 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (E,5S)-3-methyl-6-phenylmethoxyhex-2-ene-1,5-diol |
| SMILES | C/C(=C\CO)C[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C14H20O3/c1-12(7-8-15)9-14(16)11-17-10-13-5-3-2-4-6-13/h2-7,14-16H,8-11H2,1H3/b12-7+/t14-/m0/s1 |
| InChIKey | KURMAJBLBISJPH-GMMCIKNFSA-N |
| XLogP | 1.89 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|