C15H24O5 — CID 73319702
6,6-dimethoxy-1-phenylmethoxyhexane-2,4-diol (PubChem CID 73319702) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is 6,6-dimethoxy-1-phenylmethoxyhexane-2,4-diol.
| Compound Name | 6,6-dimethoxy-1-phenylmethoxyhexane-2,4-diol |
|---|---|
| PubChem CID | 73319702 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 6,6-dimethoxy-1-phenylmethoxyhexane-2,4-diol |
| SMILES | COC(CC(O)CC(O)COCc1ccccc1)OC |
| InChI | InChI=1S/C15H24O5/c1-18-15(19-2)9-13(16)8-14(17)11-20-10-12-6-4-3-5-7-12/h3-7,13-17H,8-11H2,1-2H3 |
| InChIKey | JKQSWJHBQZFSJX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|