C17H26O5 — CID 142188998
2-methylpropyl (3R,5S)-3,5-dihydroxy-6-phenylmethoxyhexanoate (PubChem CID 142188998) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-methylpropyl (3R,5S)-3,5-dihydroxy-6-phenylmethoxyhexanoate.
| Compound Name | 2-methylpropyl (3R,5S)-3,5-dihydroxy-6-phenylmethoxyhexanoate |
|---|---|
| PubChem CID | 142188998 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-methylpropyl (3R,5S)-3,5-dihydroxy-6-phenylmethoxyhexanoate |
| SMILES | CC(C)COC(=O)C[C@H](O)C[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C17H26O5/c1-13(2)10-22-17(20)9-15(18)8-16(19)12-21-11-14-6-4-3-5-7-14/h3-7,13,15-16,18-19H,8-12H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | JHIYOZXUDDUUSE-CVEARBPZSA-N |
| XLogP | 1.90 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |